C5H7F3O2 — CID 58151494
1,1,2-trifluoro-2-(2-methoxyethoxy)ethene (PubChem CID 58151494) has the molecular formula C5H7F3O2 and a molecular weight of 156.10 g/mol. Its IUPAC name is 1,1,2-trifluoro-2-(2-methoxyethoxy)ethene.
| Compound Name | 1,1,2-trifluoro-2-(2-methoxyethoxy)ethene |
|---|---|
| PubChem CID | 58151494 |
| Molecular Formula | C5H7F3O2 |
| Molecular Weight | 156.10 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 1,1,2-trifluoro-2-(2-methoxyethoxy)ethene |
| SMILES | COCCOC(F)=C(F)F |
| InChI | InChI=1S/C5H7F3O2/c1-9-2-3-10-5(8)4(6)7/h2-3H2,1H3 |
| InChIKey | NHBGHHVQLWQGOI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.10 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|