C8H10F3NO — CID 87328164
6-(1,2,2-trifluoroethenoxy)hexanenitrile (PubChem CID 87328164) has the molecular formula C8H10F3NO and a molecular weight of 193.17 g/mol. Its IUPAC name is 6-(1,2,2-trifluoroethenoxy)hexanenitrile.
| Compound Name | 6-(1,2,2-trifluoroethenoxy)hexanenitrile |
|---|---|
| PubChem CID | 87328164 |
| Molecular Formula | C8H10F3NO |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 6-(1,2,2-trifluoroethenoxy)hexanenitrile |
| SMILES | N#CCCCCCOC(F)=C(F)F |
| InChI | InChI=1S/C8H10F3NO/c9-7(10)8(11)13-6-4-2-1-3-5-12/h1-4,6H2 |
| InChIKey | VVUCQPBESUZIAP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|