C40H29N5O4 — CID 158262065
9-[4-methyl-5-(trideuteriomethyl)pyrimidin-2-yl]-2,7-bis(3-pyridin-2-yloxyphenoxy)carbazole (PubChem CID 158262065) has the molecular formula C40H29N5O4 and a molecular weight of 646.72 g/mol. Its IUPAC name is 9-[4-methyl-5-(trideuteriomethyl)pyrimidin-2-yl]-2,7-bis(3-pyridin-2-yloxyphenoxy)carbazole.
| Compound Name | 9-[4-methyl-5-(trideuteriomethyl)pyrimidin-2-yl]-2,7-bis(3-pyridin-2-yloxyphenoxy)carbazole |
|---|---|
| PubChem CID | 158262065 |
| Molecular Formula | C40H29N5O4 |
| Molecular Weight | 646.72 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 9-[4-methyl-5-(trideuteriomethyl)pyrimidin-2-yl]-2,7-bis(3-pyridin-2-yloxyphenoxy)carbazole |
| SMILES | [2H]C([2H])([2H])c1cnc(-n2c3cc(Oc4cccc(Oc5ccccn5)c4)ccc3c3ccc(Oc4cccc(Oc5ccccn5)c4)cc32)nc1C |
| InChI | InChI=1S/C40H29N5O4/c1-26-25-43-40(44-27(26)2)45-36-23-32(46-28-9-7-11-30(21-28)48-38-13-3-5-19-41-38)15-17-34(36)35-18-16-33(24-37(35)45)47-29-10-8-12-31(22-29)49-39-14-4-6-20-42-39/h3-25H,1-2H3/i1D3 |
| InChIKey | LHLKFMUPQJDXMQ-FIBGUPNXSA-N |
| XLogP | 10.15 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.72 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |