C20H20ClN5O7 — CID 158262631
6-(aminomethyl)-4H-1,4-benzoxazin-3-one;ethyl 7-nitro-4-oxo-3H-quinazoline-2-carboxylate;hydrochloride (PubChem CID 158262631) has the molecular formula C20H20ClN5O7 and a molecular weight of 477.86 g/mol. Its IUPAC name is 6-(aminomethyl)-4H-1,4-benzoxazin-3-one;ethyl 7-nitro-4-oxo-3H-quinazoline-2-carboxylate;hydrochloride.
| Compound Name | 6-(aminomethyl)-4H-1,4-benzoxazin-3-one;ethyl 7-nitro-4-oxo-3H-quinazoline-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 158262631 |
| Molecular Formula | C20H20ClN5O7 |
| Molecular Weight | 477.86 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 6-(aminomethyl)-4H-1,4-benzoxazin-3-one;ethyl 7-nitro-4-oxo-3H-quinazoline-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1nc2cc([N+](=O)[O-])ccc2c(=O)[nH]1.Cl.NCc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C11H9N3O5.C9H10N2O2.ClH/c1-2-19-11(16)9-12-8-5-6(14(17)18)3-4-7(8)10(15)13-9;10-4-6-1-2-8-7(3-6)11-9(12)5-13-8;/h3-5H,2H2,1H3,(H,12,13,15);1-3H,4-5,10H2,(H,11,12);1H |
| InChIKey | HKCRWULTIIFPJA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 179.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.86 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|