C21H19NO6S — CID 158262779
6-[[3-hydroxy-5-(3-oxobutyl)phenyl]methyl]-5,8-dioxonaphthalene-1-sulfonamide (PubChem CID 158262779) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is 6-[[3-hydroxy-5-(3-oxobutyl)phenyl]methyl]-5,8-dioxonaphthalene-1-sulfonamide.
| Compound Name | 6-[[3-hydroxy-5-(3-oxobutyl)phenyl]methyl]-5,8-dioxonaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 158262779 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 6-[[3-hydroxy-5-(3-oxobutyl)phenyl]methyl]-5,8-dioxonaphthalene-1-sulfonamide |
| SMILES | CC(=O)CCc1cc(O)cc(CC2=CC(=O)c3c(cccc3S(N)(=O)=O)C2=O)c1 |
| InChI | InChI=1S/C21H19NO6S/c1-12(23)5-6-13-7-14(10-16(24)9-13)8-15-11-18(25)20-17(21(15)26)3-2-4-19(20)29(22,27)28/h2-4,7,9-11,24H,5-6,8H2,1H3,(H2,22,27,28) |
| InChIKey | QKCRZJSJNGZTCD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|