C15H14O5S — CID 18949685
2-(4-hydroxy-2,5-dimethylbenzoyl)benzenesulfonic acid (PubChem CID 18949685) has the molecular formula C15H14O5S and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-(4-hydroxy-2,5-dimethylbenzoyl)benzenesulfonic acid.
| Compound Name | 2-(4-hydroxy-2,5-dimethylbenzoyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 18949685 |
| Molecular Formula | C15H14O5S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(4-hydroxy-2,5-dimethylbenzoyl)benzenesulfonic acid |
| SMILES | Cc1cc(C(=O)c2ccccc2S(=O)(=O)O)c(C)cc1O |
| InChI | InChI=1S/C15H14O5S/c1-9-8-13(16)10(2)7-12(9)15(17)11-5-3-4-6-14(11)21(18,19)20/h3-8,16H,1-2H3,(H,18,19,20) |
| InChIKey | PTPGCWGSNXHJGC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|