C12H22BO3P — CID 158264893
CID 158264893 (PubChem CID 158264893) has the molecular formula C12H22BO3P and a molecular weight of 256.09 g/mol.
| Compound Name | CID 158264893 |
|---|---|
| PubChem CID | 158264893 |
| Molecular Formula | C12H22BO3P |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | — |
| SMILES | [B]C1OC(CCP(=C)(C)C)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C12H22BO3P/c1-12(2)15-9-8(6-7-17(3,4)5)14-11(13)10(9)16-12/h8-11H,3,6-7H2,1-2,4-5H3 |
| InChIKey | MSECVTCPLVFYQM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|