C32H37NO5 — CID 158265416
[(1R,2S,6R,14R,15R,19R)-11-hydroxy-19-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-5-yl]-phenylmethanone (PubChem CID 158265416) has the molecular formula C32H37NO5 and a molecular weight of 515.65 g/mol. Its IUPAC name is [(1R,2S,6R,14R,15R,19R)-11-hydroxy-19-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-5-yl]-phenylmethanone.
| Compound Name | [(1R,2S,6R,14R,15R,19R)-11-hydroxy-19-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 158265416 |
| Molecular Formula | C32H37NO5 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | [(1R,2S,6R,14R,15R,19R)-11-hydroxy-19-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-5-yl]-phenylmethanone |
| SMILES | CO[C@]12C=C[C@@]3(C[C@@H]1[C@](C)(O)C(C)(C)C)[C@H]1Cc4ccc(O)c5c4[C@@]3(CCN1C(=O)c1ccccc1)[C@H]2O5 |
| InChI | InChI=1S/C32H37NO5/c1-28(2,3)29(4,36)22-18-30-13-14-32(22,37-5)27-31(30)15-16-33(26(35)19-9-7-6-8-10-19)23(30)17-20-11-12-21(34)25(38-27)24(20)31/h6-14,22-23,27,34,36H,15-18H2,1-5H3/t22-,23-,27-,29+,30-,31+,32-/m1/s1 |
| InChIKey | CUIXSLSWDGWMOL-GBWWJKROSA-N |
| XLogP | 4.62 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|