C32H39NO4 — CID 162456814
(1R,2S,6R,14R,15R,19R)-5-benzyl-19-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-ol (PubChem CID 162456814) has the molecular formula C32H39NO4 and a molecular weight of 501.67 g/mol. Its IUPAC name is (1R,2S,6R,14R,15R,19R)-5-benzyl-19-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-ol.
| Compound Name | (1R,2S,6R,14R,15R,19R)-5-benzyl-19-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-ol |
|---|---|
| PubChem CID | 162456814 |
| Molecular Formula | C32H39NO4 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | (1R,2S,6R,14R,15R,19R)-5-benzyl-19-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-ol |
| SMILES | CO[C@]12C=C[C@@]3(C[C@@H]1C(C)(O)C(C)(C)C)[C@H]1Cc4ccc(O)c5c4[C@@]3(CCN1Cc1ccccc1)[C@H]2O5 |
| InChI | InChI=1S/C32H39NO4/c1-28(2,3)29(4,35)23-18-30-13-14-32(23,36-5)27-31(30)15-16-33(19-20-9-7-6-8-10-20)24(30)17-21-11-12-22(34)26(37-27)25(21)31/h6-14,23-24,27,34-35H,15-19H2,1-5H3/t23-,24-,27-,29?,30-,31+,32-/m1/s1 |
| InChIKey | VGWJFMNKNYFUIU-XPSKUFLISA-N |
| XLogP | 4.98 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|