C23H29ClN10O6 — CID 158265648
(3S)-4-(4-chloro-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine;(3S)-4-(4-imidazol-1-yl-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine (PubChem CID 158265648) has the molecular formula C23H29ClN10O6 and a molecular weight of 577.00 g/mol. Its IUPAC name is (3S)-4-(4-chloro-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine;(3S)-4-(4-imidazol-1-yl-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine.
| Compound Name | (3S)-4-(4-chloro-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine;(3S)-4-(4-imidazol-1-yl-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine |
|---|---|
| PubChem CID | 158265648 |
| Molecular Formula | C23H29ClN10O6 |
| Molecular Weight | 577.00 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | (3S)-4-(4-chloro-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine;(3S)-4-(4-imidazol-1-yl-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine |
| SMILES | Cc1nc(N2CCOC[C@@H]2C)nc(-n2ccnc2)c1[N+](=O)[O-].Cc1nc(N2CCOC[C@@H]2C)nc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N6O3.C10H13ClN4O3/c1-9-7-22-6-5-18(9)13-15-10(2)11(19(20)21)12(16-13)17-4-3-14-8-17;1-6-5-18-4-3-14(6)10-12-7(2)8(15(16)17)9(11)13-10/h3-4,8-9H,5-7H2,1-2H3;6H,3-5H2,1-2H3/t9-;6-/m00/s1 |
| InChIKey | GIKFKRVAJUEKCH-NRDCADONSA-N |
| XLogP | 2.68 |
| TPSA | 180.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.00 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|