C14H20N6O6S — CID 137331932
(3S)-4-(4-imidazol-1-yl-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine;methanesulfonic acid (PubChem CID 137331932) has the molecular formula C14H20N6O6S and a molecular weight of 400.42 g/mol. Its IUPAC name is (3S)-4-(4-imidazol-1-yl-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine;methanesulfonic acid.
| Compound Name | (3S)-4-(4-imidazol-1-yl-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine;methanesulfonic acid |
|---|---|
| PubChem CID | 137331932 |
| Molecular Formula | C14H20N6O6S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (3S)-4-(4-imidazol-1-yl-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1nc(N2CCOC[C@@H]2C)nc(-n2ccnc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N6O3.CH4O3S/c1-9-7-22-6-5-18(9)13-15-10(2)11(19(20)21)12(16-13)17-4-3-14-8-17;1-5(2,3)4/h3-4,8-9H,5-7H2,1-2H3;1H3,(H,2,3,4)/t9-;/m0./s1 |
| InChIKey | BHTKJWQHICPXFY-FVGYRXGTSA-N |
| XLogP | 0.61 |
| TPSA | 153.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|