C20H25N5O4 — CID 68761442
(3R)-3-methyl-4-[6-[(3R)-3-methylmorpholin-4-yl]-2-(4-nitrophenyl)pyrimidin-4-yl]morpholine (PubChem CID 68761442) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is (3R)-3-methyl-4-[6-[(3R)-3-methylmorpholin-4-yl]-2-(4-nitrophenyl)pyrimidin-4-yl]morpholine.
| Compound Name | (3R)-3-methyl-4-[6-[(3R)-3-methylmorpholin-4-yl]-2-(4-nitrophenyl)pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 68761442 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (3R)-3-methyl-4-[6-[(3R)-3-methylmorpholin-4-yl]-2-(4-nitrophenyl)pyrimidin-4-yl]morpholine |
| SMILES | C[C@@H]1COCCN1c1cc(N2CCOC[C@H]2C)nc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C20H25N5O4/c1-14-12-28-9-7-23(14)18-11-19(24-8-10-29-13-15(24)2)22-20(21-18)16-3-5-17(6-4-16)25(26)27/h3-6,11,14-15H,7-10,12-13H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | PTZBUCVCARMCRO-HUUCEWRRSA-N |
| XLogP | 2.50 |
| TPSA | 93.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|