C23H26N6O2S — CID 87544958
1-methyl-3-[4-[4-[(3S)-3-methylmorpholin-4-yl]-6-[pyridin-4-yl(sulfanyl)methyl]pyrimidin-2-yl]phenyl]urea (PubChem CID 87544958) has the molecular formula C23H26N6O2S and a molecular weight of 450.57 g/mol. Its IUPAC name is 1-methyl-3-[4-[4-[(3S)-3-methylmorpholin-4-yl]-6-[pyridin-4-yl(sulfanyl)methyl]pyrimidin-2-yl]phenyl]urea.
| Compound Name | 1-methyl-3-[4-[4-[(3S)-3-methylmorpholin-4-yl]-6-[pyridin-4-yl(sulfanyl)methyl]pyrimidin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 87544958 |
| Molecular Formula | C23H26N6O2S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-methyl-3-[4-[4-[(3S)-3-methylmorpholin-4-yl]-6-[pyridin-4-yl(sulfanyl)methyl]pyrimidin-2-yl]phenyl]urea |
| SMILES | CNC(=O)Nc1ccc(-c2nc(C(S)c3ccncc3)cc(N3CCOC[C@@H]3C)n2)cc1 |
| InChI | InChI=1S/C23H26N6O2S/c1-15-14-31-12-11-29(15)20-13-19(21(32)16-7-9-25-10-8-16)27-22(28-20)17-3-5-18(6-4-17)26-23(30)24-2/h3-10,13,15,21,32H,11-12,14H2,1-2H3,(H2,24,26,30)/t15-,21?/m0/s1 |
| InChIKey | XHTMGRHELAUBEW-ZDGMYTEDSA-N |
| XLogP | 3.53 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|