C24H26FN5O2S — CID 87544256
1-[4-[4-[(4-fluorophenyl)-sulfanylmethyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-methylurea (PubChem CID 87544256) has the molecular formula C24H26FN5O2S and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-[4-[4-[(4-fluorophenyl)-sulfanylmethyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-methylurea.
| Compound Name | 1-[4-[4-[(4-fluorophenyl)-sulfanylmethyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 87544256 |
| Molecular Formula | C24H26FN5O2S |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 1-[4-[4-[(4-fluorophenyl)-sulfanylmethyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(-c2nc(C(S)c3ccc(F)cc3)cc(N3CCOC[C@@H]3C)n2)cc1 |
| InChI | InChI=1S/C24H26FN5O2S/c1-15-14-32-12-11-30(15)21-13-20(22(33)16-3-7-18(25)8-4-16)28-23(29-21)17-5-9-19(10-6-17)27-24(31)26-2/h3-10,13,15,22,33H,11-12,14H2,1-2H3,(H2,26,27,31)/t15-,22?/m0/s1 |
| InChIKey | KLZUKRACBUXFQY-UEDXYCIISA-N |
| XLogP | 4.28 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|