C24H16N4O4 — CID 158267302
1,10-dihydro-1,10-phenanthroline-4,7-dione (PubChem CID 158267302) has the molecular formula C24H16N4O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is 1,10-dihydro-1,10-phenanthroline-4,7-dione.
| Compound Name | 1,10-dihydro-1,10-phenanthroline-4,7-dione |
|---|---|
| PubChem CID | 158267302 |
| Molecular Formula | C24H16N4O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1,10-dihydro-1,10-phenanthroline-4,7-dione |
| SMILES | O=c1cc[nH]c2c1ccc1c(=O)cc[nH]c12.O=c1cc[nH]c2c1ccc1c(=O)cc[nH]c12 |
| InChI | InChI=1S/2C12H8N2O2/c2*15-9-3-5-13-11-7(9)1-2-8-10(16)4-6-14-12(8)11/h2*1-6H,(H,13,15)(H,14,16) |
| InChIKey | GIPKMVLEBWGEGX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|