C23H47N3O5 — CID 158267524
2-amino-6-methoxyheptanenitrile;(2S)-2-amino-6-methoxyheptanoic acid;5-methylhexanal (PubChem CID 158267524) has the molecular formula C23H47N3O5 and a molecular weight of 445.65 g/mol. Its IUPAC name is 2-amino-6-methoxyheptanenitrile;(2S)-2-amino-6-methoxyheptanoic acid;5-methylhexanal.
| Compound Name | 2-amino-6-methoxyheptanenitrile;(2S)-2-amino-6-methoxyheptanoic acid;5-methylhexanal |
|---|---|
| PubChem CID | 158267524 |
| Molecular Formula | C23H47N3O5 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.35 |
| IUPAC Name | 2-amino-6-methoxyheptanenitrile;(2S)-2-amino-6-methoxyheptanoic acid;5-methylhexanal |
| SMILES | CC(C)CCCC=O.COC(C)CCCC(N)C#N.COC(C)CCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H16N2O.C8H17NO3.C7H14O/c1-7(11-2)4-3-5-8(10)6-9;1-6(12-2)4-3-5-7(9)8(10)11;1-7(2)5-3-4-6-8/h7-8H,3-5,10H2,1-2H3;6-7H,3-5,9H2,1-2H3,(H,10,11);6-7H,3-5H2,1-2H3/t;6?,7-;/m.0./s1 |
| InChIKey | GIQCBLRDKLBMEB-FNHQBQTKSA-N |
| XLogP | 3.66 |
| TPSA | 148.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|