C24H49N3O6 — CID 157440259
2-amino-6-methoxyheptanenitrile;(2R)-2-amino-6-methylheptanoic acid;6,6-dimethoxyhexanal (PubChem CID 157440259) has the molecular formula C24H49N3O6 and a molecular weight of 475.67 g/mol. Its IUPAC name is 2-amino-6-methoxyheptanenitrile;(2R)-2-amino-6-methylheptanoic acid;6,6-dimethoxyhexanal.
| Compound Name | 2-amino-6-methoxyheptanenitrile;(2R)-2-amino-6-methylheptanoic acid;6,6-dimethoxyhexanal |
|---|---|
| PubChem CID | 157440259 |
| Molecular Formula | C24H49N3O6 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.36 |
| IUPAC Name | 2-amino-6-methoxyheptanenitrile;(2R)-2-amino-6-methylheptanoic acid;6,6-dimethoxyhexanal |
| SMILES | CC(C)CCC[C@@H](N)C(=O)O.COC(C)CCCC(N)C#N.COC(CCCCC=O)OC |
| InChI | InChI=1S/C8H16N2O.C8H17NO2.C8H16O3/c1-7(11-2)4-3-5-8(10)6-9;1-6(2)4-3-5-7(9)8(10)11;1-10-8(11-2)6-4-3-5-7-9/h7-8H,3-5,10H2,1-2H3;6-7H,3-5,9H2,1-2H3,(H,10,11);7-8H,3-6H2,1-2H3/t;7-;/m.1./s1 |
| InChIKey | BRPBGGXFFASVSJ-QABCSGHHSA-N |
| XLogP | 3.63 |
| TPSA | 157.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|