About benzenethiol;2H-benzotriazole
benzenethiol;2H-benzotriazole (PubChem CID 158272752) has the molecular formula C12H11N3S
and a molecular weight of 229.31 g/mol. Its IUPAC name is benzenethiol;2H-benzotriazole.
Molecular Properties
| Compound Name | benzenethiol;2H-benzotriazole |
| PubChem CID | 158272752 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | benzenethiol;2H-benzotriazole |
| SMILES | Sc1ccccc1.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.C6H6S/c1-2-4-6-5(3-1)7-9-8-6;7-6-4-2-1-3-5-6/h1-4H,(H,7,8,9);1-5,7H |
| InChIKey | GJGAAOVWYXERBS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzenethiol;2H-benzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenethiol;2H-benzotriazole?
The IUPAC name of benzenethiol;2H-benzotriazole (CID 158272752) is benzenethiol;2H-benzotriazole.
What is the SMILES notation for benzenethiol;2H-benzotriazole?
The canonical SMILES for benzenethiol;2H-benzotriazole is Sc1ccccc1.c1ccc2n[nH]nc2c1.
What is the InChIKey of benzenethiol;2H-benzotriazole?
The InChIKey is GJGAAOVWYXERBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.C6H6S/c1-2-4-6-5(3-1)7-9-8-6;7-6-4-2-1-3-5-6/h1-4H,(H,7,8,9);1-5,7H.
What are the key properties of benzenethiol;2H-benzotriazole?
benzenethiol;2H-benzotriazole has a molecular weight of 229.31 g/mol, XLogP of 2.93, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenethiol;2H-benzotriazole is sourced from PubChem (CID 158272752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).