C30H43ClN2O7 — CID 158274311
2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanamine;(E)-N-(2-methoxyethyl)-3-phenylprop-2-enamide;(E)-3-phenylprop-2-enoyl chloride (PubChem CID 158274311) has the molecular formula C30H43ClN2O7 and a molecular weight of 579.13 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanamine;(E)-N-(2-methoxyethyl)-3-phenylprop-2-enamide;(E)-3-phenylprop-2-enoyl chloride.
| Compound Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanamine;(E)-N-(2-methoxyethyl)-3-phenylprop-2-enamide;(E)-3-phenylprop-2-enoyl chloride |
|---|---|
| PubChem CID | 158274311 |
| Molecular Formula | C30H43ClN2O7 |
| Molecular Weight | 579.13 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanamine;(E)-N-(2-methoxyethyl)-3-phenylprop-2-enamide;(E)-3-phenylprop-2-enoyl chloride |
| SMILES | COCCNC(=O)/C=C/c1ccccc1.COCCOCCOCCOCCN.O=C(Cl)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H15NO2.C9H7ClO.C9H21NO4/c1-15-10-9-13-12(14)8-7-11-5-3-2-4-6-11;10-9(11)7-6-8-4-2-1-3-5-8;1-11-4-5-13-8-9-14-7-6-12-3-2-10/h2-8H,9-10H2,1H3,(H,13,14);1-7H;2-10H2,1H3/b8-7+;7-6+; |
| InChIKey | GJKMRZRSTWXBTO-NHFBBFJXSA-N |
| XLogP | 3.57 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.13 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|