C15H20O7 — CID 158277052
[1-[2-(4-methyl-3-oxopent-4-enoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 2-methylprop-2-enoate (PubChem CID 158277052) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is [1-[2-(4-methyl-3-oxopent-4-enoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-[2-(4-methyl-3-oxopent-4-enoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158277052 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [1-[2-(4-methyl-3-oxopent-4-enoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)CCOC(=O)COC(=O)C(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C15H20O7/c1-9(2)12(16)6-7-20-13(17)8-21-15(19)11(5)22-14(18)10(3)4/h11H,1,3,6-8H2,2,4-5H3 |
| InChIKey | DYBUQKXOOPCNEP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|