About benzonitrile;4-(imidazol-1-ylamino)benzonitrile
benzonitrile;4-(imidazol-1-ylamino)benzonitrile (PubChem CID 158279093) has the molecular formula C17H13N5
and a molecular weight of 287.33 g/mol. Its IUPAC name is benzonitrile;4-(imidazol-1-ylamino)benzonitrile.
Molecular Properties
| Compound Name | benzonitrile;4-(imidazol-1-ylamino)benzonitrile |
| PubChem CID | 158279093 |
| Molecular Formula | C17H13N5 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | benzonitrile;4-(imidazol-1-ylamino)benzonitrile |
| SMILES | N#Cc1ccc(Nn2ccnc2)cc1.N#Cc1ccccc1 |
| InChI | InChI=1S/C10H8N4.C7H5N/c11-7-9-1-3-10(4-2-9)13-14-6-5-12-8-14;8-6-7-4-2-1-3-5-7/h1-6,8,13H;1-5H |
| InChIKey | GJZHSBVCRASPEA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzonitrile;4-(imidazol-1-ylamino)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzonitrile;4-(imidazol-1-ylamino)benzonitrile?
The IUPAC name of benzonitrile;4-(imidazol-1-ylamino)benzonitrile (CID 158279093) is benzonitrile;4-(imidazol-1-ylamino)benzonitrile.
What is the SMILES notation for benzonitrile;4-(imidazol-1-ylamino)benzonitrile?
The canonical SMILES for benzonitrile;4-(imidazol-1-ylamino)benzonitrile is N#Cc1ccc(Nn2ccnc2)cc1.N#Cc1ccccc1.
What is the InChIKey of benzonitrile;4-(imidazol-1-ylamino)benzonitrile?
The InChIKey is GJZHSBVCRASPEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4.C7H5N/c11-7-9-1-3-10(4-2-9)13-14-6-5-12-8-14;8-6-7-4-2-1-3-5-7/h1-6,8,13H;1-5H.
What are the key properties of benzonitrile;4-(imidazol-1-ylamino)benzonitrile?
benzonitrile;4-(imidazol-1-ylamino)benzonitrile has a molecular weight of 287.33 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzonitrile;4-(imidazol-1-ylamino)benzonitrile is sourced from PubChem (CID 158279093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).