C14H22O2Si — CID 15828078
4-hydroxy-5,5-dimethyl-3-methylidene-1-trimethylsilyl-4,6-dihydro-3aH-pentalen-2-one (PubChem CID 15828078) has the molecular formula C14H22O2Si and a molecular weight of 250.41 g/mol. Its IUPAC name is 4-hydroxy-5,5-dimethyl-3-methylidene-1-trimethylsilyl-4,6-dihydro-3aH-pentalen-2-one.
| Compound Name | 4-hydroxy-5,5-dimethyl-3-methylidene-1-trimethylsilyl-4,6-dihydro-3aH-pentalen-2-one |
|---|---|
| PubChem CID | 15828078 |
| Molecular Formula | C14H22O2Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 4-hydroxy-5,5-dimethyl-3-methylidene-1-trimethylsilyl-4,6-dihydro-3aH-pentalen-2-one |
| SMILES | C=C1C(=O)C([Si](C)(C)C)=C2CC(C)(C)C(O)C12 |
| InChI | InChI=1S/C14H22O2Si/c1-8-10-9(7-14(2,3)13(10)16)12(11(8)15)17(4,5)6/h10,13,16H,1,7H2,2-6H3 |
| InChIKey | NRMDUZDNVGKGPH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|