About 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane
1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane (PubChem CID 158288495) has the molecular formula C19H22F3N3O2
and a molecular weight of 381.40 g/mol. Its IUPAC name is 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane.
Molecular Properties
| Compound Name | 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane |
| PubChem CID | 158288495 |
| Molecular Formula | C19H22F3N3O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane |
| SMILES | C1=CC=CNC=C1.O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CCCCCC1 |
| InChI | InChI=1S/C13H15F3N2O2.C6H7N/c14-13(15,16)10-5-6-11(12(9-10)18(19)20)17-7-3-1-2-4-8-17;1-2-4-6-7-5-3-1/h5-6,9H,1-4,7-8H2;1-7H |
| InChIKey | GLBNOBYLLXHZFU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane?
The IUPAC name of 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane (CID 158288495) is 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane.
What is the SMILES notation for 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane?
The canonical SMILES for 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane is C1=CC=CNC=C1.O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CCCCCC1.
What is the InChIKey of 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane?
The InChIKey is GLBNOBYLLXHZFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3N2O2.C6H7N/c14-13(15,16)10-5-6-11(12(9-10)18(19)20)17-7-3-1-2-4-8-17;1-2-4-6-7-5-3-1/h5-6,9H,1-4,7-8H2;1-7H.
What are the key properties of 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane?
1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane has a molecular weight of 381.40 g/mol, XLogP of 5.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azepine;1-[2-nitro-4-(trifluoromethyl)phenyl]azepane is sourced from PubChem (CID 158288495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).