C27H37NO3 — CID 158289763
ethyl (2R)-2-benzyl-3-[3-methyl-4-(3-propan-2-yloxyphenyl)piperidin-1-yl]propanoate (PubChem CID 158289763) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is ethyl (2R)-2-benzyl-3-[3-methyl-4-(3-propan-2-yloxyphenyl)piperidin-1-yl]propanoate.
| Compound Name | ethyl (2R)-2-benzyl-3-[3-methyl-4-(3-propan-2-yloxyphenyl)piperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 158289763 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | ethyl (2R)-2-benzyl-3-[3-methyl-4-(3-propan-2-yloxyphenyl)piperidin-1-yl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)CN1CCC(c2cccc(OC(C)C)c2)C(C)C1 |
| InChI | InChI=1S/C27H37NO3/c1-5-30-27(29)24(16-22-10-7-6-8-11-22)19-28-15-14-26(21(4)18-28)23-12-9-13-25(17-23)31-20(2)3/h6-13,17,20-21,24,26H,5,14-16,18-19H2,1-4H3/t21?,24-,26?/m1/s1 |
| InChIKey | GLFFZYIUHYJFBT-YRQBIXJDSA-N |
| XLogP | 5.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |