C25H34N2 — CID 142943211
3-[1-(2-benzyl-3-methylbut-3-enyl)-3-methylpiperidin-4-yl]-N-methylaniline (PubChem CID 142943211) has the molecular formula C25H34N2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 3-[1-(2-benzyl-3-methylbut-3-enyl)-3-methylpiperidin-4-yl]-N-methylaniline.
| Compound Name | 3-[1-(2-benzyl-3-methylbut-3-enyl)-3-methylpiperidin-4-yl]-N-methylaniline |
|---|---|
| PubChem CID | 142943211 |
| Molecular Formula | C25H34N2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 3-[1-(2-benzyl-3-methylbut-3-enyl)-3-methylpiperidin-4-yl]-N-methylaniline |
| SMILES | C=C(C)C(Cc1ccccc1)CN1CCC(c2cccc(NC)c2)C(C)C1 |
| InChI | InChI=1S/C25H34N2/c1-19(2)23(15-21-9-6-5-7-10-21)18-27-14-13-25(20(3)17-27)22-11-8-12-24(16-22)26-4/h5-12,16,20,23,25-26H,1,13-15,17-18H2,2-4H3 |
| InChIKey | VLUVCUPJBLOZLA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|