C34H34N8O4S2 — CID 158291013
11-cyclohexyl-5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-amine (PubChem CID 158291013) has the molecular formula C34H34N8O4S2 and a molecular weight of 682.83 g/mol. Its IUPAC name is 11-cyclohexyl-5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-amine.
| Compound Name | 11-cyclohexyl-5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-amine |
|---|---|
| PubChem CID | 158291013 |
| Molecular Formula | C34H34N8O4S2 |
| Molecular Weight | 682.83 g/mol |
| Exact Mass | 682.21 |
| IUPAC Name | 11-cyclohexyl-5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-amine |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2nc(C4CCCCC4)cn23)cc1.Cc1ccc(S(=O)(=O)n2ccc3nc(N)cnc32)cc1 |
| InChI | InChI=1S/C21H22N4O2S.C13H12N4O2S/c1-15-7-9-17(10-8-15)28(26,27)25-12-11-19-21(25)22-13-20-23-18(14-24(19)20)16-5-3-2-4-6-16;1-9-2-4-10(5-3-9)20(18,19)17-7-6-11-13(17)15-8-12(14)16-11/h7-14,16H,2-6H2,1H3;2-8H,1H3,(H2,14,16) |
| InChIKey | GLISXZIQQTXFLT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.83 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |