C14H32O5 — CID 158292542
2-methoxypentan-2-ol;2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethanol (PubChem CID 158292542) has the molecular formula C14H32O5 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-methoxypentan-2-ol;2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethanol.
| Compound Name | 2-methoxypentan-2-ol;2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 158292542 |
| Molecular Formula | C14H32O5 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-methoxypentan-2-ol;2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethanol |
| SMILES | CC(C)(C)OCCOCCO.CCCC(C)(O)OC |
| InChI | InChI=1S/C8H18O3.C6H14O2/c1-8(2,3)11-7-6-10-5-4-9;1-4-5-6(2,7)8-3/h9H,4-7H2,1-3H3;7H,4-5H2,1-3H3 |
| InChIKey | GLNNDVLYYXQOHA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|