C21H24N2O4 — CID 158297931
2-[3-[(1R)-1-phenylethyl]iminopropyl-phenylmethoxycarbonylamino]acetic acid (PubChem CID 158297931) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-[3-[(1R)-1-phenylethyl]iminopropyl-phenylmethoxycarbonylamino]acetic acid.
| Compound Name | 2-[3-[(1R)-1-phenylethyl]iminopropyl-phenylmethoxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 158297931 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-[3-[(1R)-1-phenylethyl]iminopropyl-phenylmethoxycarbonylamino]acetic acid |
| SMILES | C[C@@H](/N=C/CCN(CC(=O)O)C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O4/c1-17(19-11-6-3-7-12-19)22-13-8-14-23(15-20(24)25)21(26)27-16-18-9-4-2-5-10-18/h2-7,9-13,17H,8,14-16H2,1H3,(H,24,25)/b22-13+/t17-/m1/s1 |
| InChIKey | QLXXWWWGUPFHEF-NEIHUHTASA-N |
| XLogP | 3.93 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|