C26H52O8Si2 — CID 158300054
bis[(3-ethyloxetan-3-yl)methyl] carbonate;dimethylsilyloxy-[3-[(3-ethyloxetan-3-yl)methoxy]propyl]-dimethylsilane (PubChem CID 158300054) has the molecular formula C26H52O8Si2 and a molecular weight of 548.87 g/mol. Its IUPAC name is bis[(3-ethyloxetan-3-yl)methyl] carbonate;dimethylsilyloxy-[3-[(3-ethyloxetan-3-yl)methoxy]propyl]-dimethylsilane.
| Compound Name | bis[(3-ethyloxetan-3-yl)methyl] carbonate;dimethylsilyloxy-[3-[(3-ethyloxetan-3-yl)methoxy]propyl]-dimethylsilane |
|---|---|
| PubChem CID | 158300054 |
| Molecular Formula | C26H52O8Si2 |
| Molecular Weight | 548.87 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | bis[(3-ethyloxetan-3-yl)methyl] carbonate;dimethylsilyloxy-[3-[(3-ethyloxetan-3-yl)methoxy]propyl]-dimethylsilane |
| SMILES | CCC1(COC(=O)OCC2(CC)COC2)COC1.CCC1(COCCC[Si](C)(C)O[SiH](C)C)COC1 |
| InChI | InChI=1S/C13H22O5.C13H30O3Si2/c1-3-12(5-15-6-12)9-17-11(14)18-10-13(4-2)7-16-8-13;1-6-13(11-15-12-13)10-14-8-7-9-18(4,5)16-17(2)3/h3-10H2,1-2H3;17H,6-12H2,1-5H3 |
| InChIKey | GMJUYBIPCGXQKO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.87 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|