C33H36FN3O4 — CID 158301383
N-[(5S)-5-[3-(4-fluorophenyl)propanoylamino]-7-[(1-methylcyclopropyl)amino]-4,7-dioxoheptyl]-3-phenylbenzamide (PubChem CID 158301383) has the molecular formula C33H36FN3O4 and a molecular weight of 557.67 g/mol. Its IUPAC name is N-[(5S)-5-[3-(4-fluorophenyl)propanoylamino]-7-[(1-methylcyclopropyl)amino]-4,7-dioxoheptyl]-3-phenylbenzamide.
| Compound Name | N-[(5S)-5-[3-(4-fluorophenyl)propanoylamino]-7-[(1-methylcyclopropyl)amino]-4,7-dioxoheptyl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 158301383 |
| Molecular Formula | C33H36FN3O4 |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | N-[(5S)-5-[3-(4-fluorophenyl)propanoylamino]-7-[(1-methylcyclopropyl)amino]-4,7-dioxoheptyl]-3-phenylbenzamide |
| SMILES | CC1(NC(=O)C[C@H](NC(=O)CCc2ccc(F)cc2)C(=O)CCCNC(=O)c2cccc(-c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C33H36FN3O4/c1-33(18-19-33)37-31(40)22-28(36-30(39)17-14-23-12-15-27(34)16-13-23)29(38)11-6-20-35-32(41)26-10-5-9-25(21-26)24-7-3-2-4-8-24/h2-5,7-10,12-13,15-16,21,28H,6,11,14,17-20,22H2,1H3,(H,35,41)(H,36,39)(H,37,40)/t28-/m0/s1 |
| InChIKey | GMNPNACLEKEPCY-NDEPHWFRSA-N |
| XLogP | 4.75 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|