C32H40N4O4 — CID 129047958
N-[2-[[(2S)-4-(tert-butylamino)-1-hydroxy-4-oxo-2-(3-phenylpropanoylamino)butyl]amino]ethyl]-3-phenylbenzamide (PubChem CID 129047958) has the molecular formula C32H40N4O4 and a molecular weight of 544.70 g/mol. Its IUPAC name is N-[2-[[(2S)-4-(tert-butylamino)-1-hydroxy-4-oxo-2-(3-phenylpropanoylamino)butyl]amino]ethyl]-3-phenylbenzamide.
| Compound Name | N-[2-[[(2S)-4-(tert-butylamino)-1-hydroxy-4-oxo-2-(3-phenylpropanoylamino)butyl]amino]ethyl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 129047958 |
| Molecular Formula | C32H40N4O4 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | N-[2-[[(2S)-4-(tert-butylamino)-1-hydroxy-4-oxo-2-(3-phenylpropanoylamino)butyl]amino]ethyl]-3-phenylbenzamide |
| SMILES | CC(C)(C)NC(=O)C[C@H](NC(=O)CCc1ccccc1)C(O)NCCNC(=O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C32H40N4O4/c1-32(2,3)36-29(38)22-27(35-28(37)18-17-23-11-6-4-7-12-23)31(40)34-20-19-33-30(39)26-16-10-15-25(21-26)24-13-8-5-9-14-24/h4-16,21,27,31,34,40H,17-20,22H2,1-3H3,(H,33,39)(H,35,37)(H,36,38)/t27-,31?/m0/s1 |
| InChIKey | GUBQTFNZMQJZQA-LMUZMDBKSA-N |
| XLogP | 3.41 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|