C17H22N4O8 — CID 158301814
(2S)-4-amino-2-[[(2R,5S)-5-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-2-methyl-4-oxohexanoyl]amino]-4-oxobutanoic acid (PubChem CID 158301814) has the molecular formula C17H22N4O8 and a molecular weight of 410.38 g/mol. Its IUPAC name is (2S)-4-amino-2-[[(2R,5S)-5-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-2-methyl-4-oxohexanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[[(2R,5S)-5-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-2-methyl-4-oxohexanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 158301814 |
| Molecular Formula | C17H22N4O8 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (2S)-4-amino-2-[[(2R,5S)-5-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-2-methyl-4-oxohexanoyl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](CC(=O)[C@H](C)NC(=O)CN1C(=O)C=CC1=O)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C17H22N4O8/c1-8(16(27)20-10(17(28)29)6-12(18)23)5-11(22)9(2)19-13(24)7-21-14(25)3-4-15(21)26/h3-4,8-10H,5-7H2,1-2H3,(H2,18,23)(H,19,24)(H,20,27)(H,28,29)/t8-,9+,10+/m1/s1 |
| InChIKey | GMOWMPHZRCZXNG-UTLUCORTSA-N |
| XLogP | -2.54 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|