About 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile
3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile (PubChem CID 158301842) has the molecular formula C20H14N4O2S2
and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile |
| PubChem CID | 158301842 |
| Molecular Formula | C20H14N4O2S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile |
| SMILES | Cc1cc(C#N)ccc1-c1nccc2cc(S(=O)(=O)Cc3ncns3)ccc12 |
| InChI | InChI=1S/C20H14N4O2S2/c1-13-8-14(10-21)2-4-17(13)20-18-5-3-16(9-15(18)6-7-22-20)28(25,26)11-19-23-12-24-27-19/h2-9,12H,11H2,1H3 |
| InChIKey | GMOYKPHFVFHKQP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile?
The IUPAC name of 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile (CID 158301842) is 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile.
What is the SMILES notation for 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile?
The canonical SMILES for 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile is Cc1cc(C#N)ccc1-c1nccc2cc(S(=O)(=O)Cc3ncns3)ccc12.
What is the InChIKey of 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile?
The InChIKey is GMOYKPHFVFHKQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4O2S2/c1-13-8-14(10-21)2-4-17(13)20-18-5-3-16(9-15(18)6-7-22-20)28(25,26)11-19-23-12-24-27-19/h2-9,12H,11H2,1H3.
What are the key properties of 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile?
3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile has a molecular weight of 406.49 g/mol, XLogP of 3.91, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-[6-(1,2,4-thiadiazol-5-ylmethylsulfonyl)isoquinolin-1-yl]benzonitrile is sourced from PubChem (CID 158301842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).