C18H14ClN5O2S — CID 134306540
2-amino-N-[5-chloro-6-(4-cyano-2-methylphenyl)-2-pyridinyl]pyridine-4-sulfonamide (PubChem CID 134306540) has the molecular formula C18H14ClN5O2S and a molecular weight of 399.86 g/mol. Its IUPAC name is 2-amino-N-[5-chloro-6-(4-cyano-2-methylphenyl)-2-pyridinyl]pyridine-4-sulfonamide.
| Compound Name | 2-amino-N-[5-chloro-6-(4-cyano-2-methylphenyl)-2-pyridinyl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 134306540 |
| Molecular Formula | C18H14ClN5O2S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2-amino-N-[5-chloro-6-(4-cyano-2-methylphenyl)-2-pyridinyl]pyridine-4-sulfonamide |
| SMILES | Cc1cc(C#N)ccc1-c1nc(NS(=O)(=O)c2ccnc(N)c2)ccc1Cl |
| InChI | InChI=1S/C18H14ClN5O2S/c1-11-8-12(10-20)2-3-14(11)18-15(19)4-5-17(23-18)24-27(25,26)13-6-7-22-16(21)9-13/h2-9H,1H3,(H2,21,22)(H,23,24) |
| InChIKey | VYPGMFRSTQGFFO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |