C8H6F12MoO2-2 — CID 158302613
bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-olate);molybdenum (PubChem CID 158302613) has the molecular formula C8H6F12MoO2-2 and a molecular weight of 458.05 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-olate);molybdenum.
| Compound Name | bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-olate);molybdenum |
|---|---|
| PubChem CID | 158302613 |
| Molecular Formula | C8H6F12MoO2-2 |
| Molecular Weight | 458.05 g/mol |
| Exact Mass | 459.92 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-olate);molybdenum |
| SMILES | CC([O-])(C(F)(F)F)C(F)(F)F.CC([O-])(C(F)(F)F)C(F)(F)F.[Mo] |
| InChI | InChI=1S/2C4H3F6O.Mo/c2*1-2(11,3(5,6)7)4(8,9)10;/h2*1H3;/q2*-1; |
| InChIKey | RPZLUQNWAHVWBX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.05 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |