C3F7LiO — CID 88813201
lithium 1,1,1,2,3,3,3-heptafluoropropan-2-olate (PubChem CID 88813201) has the molecular formula C3F7LiO and a molecular weight of 191.96 g/mol. Its IUPAC name is lithium 1,1,1,2,3,3,3-heptafluoropropan-2-olate.
| Compound Name | lithium 1,1,1,2,3,3,3-heptafluoropropan-2-olate |
|---|---|
| PubChem CID | 88813201 |
| Molecular Formula | C3F7LiO |
| Molecular Weight | 191.96 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | lithium 1,1,1,2,3,3,3-heptafluoropropan-2-olate |
| SMILES | [Li+].[O-]C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C3F7O.Li/c4-1(11,2(5,6)7)3(8,9)10;/q-1;+1 |
| InChIKey | VGKQPCALDLEVPN-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.96 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |