C3HF6LiO — CID 87456805
lithium 1,1,1,2,3,3-hexafluoropropan-2-olate (PubChem CID 87456805) has the molecular formula C3HF6LiO and a molecular weight of 173.97 g/mol. Its IUPAC name is lithium 1,1,1,2,3,3-hexafluoropropan-2-olate.
| Compound Name | lithium 1,1,1,2,3,3-hexafluoropropan-2-olate |
|---|---|
| PubChem CID | 87456805 |
| Molecular Formula | C3HF6LiO |
| Molecular Weight | 173.97 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | lithium 1,1,1,2,3,3-hexafluoropropan-2-olate |
| SMILES | [Li+].[O-]C(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C3HF6O.Li/c4-1(5)2(6,10)3(7,8)9;/h1H;/q-1;+1 |
| InChIKey | MEUCKYISCQRBMU-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.97 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |