C28H34F3NO3 — CID 158303102
(9aR,11aS)-9a,11a-dimethyl-1-[2-[4-methyl-2-(trifluoromethoxy)phenyl]acetyl]-1,2,3,3a,3b,4,5,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridin-7-one (PubChem CID 158303102) has the molecular formula C28H34F3NO3 and a molecular weight of 489.58 g/mol. Its IUPAC name is (9aR,11aS)-9a,11a-dimethyl-1-[2-[4-methyl-2-(trifluoromethoxy)phenyl]acetyl]-1,2,3,3a,3b,4,5,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridin-7-one.
| Compound Name | (9aR,11aS)-9a,11a-dimethyl-1-[2-[4-methyl-2-(trifluoromethoxy)phenyl]acetyl]-1,2,3,3a,3b,4,5,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridin-7-one |
|---|---|
| PubChem CID | 158303102 |
| Molecular Formula | C28H34F3NO3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | (9aR,11aS)-9a,11a-dimethyl-1-[2-[4-methyl-2-(trifluoromethoxy)phenyl]acetyl]-1,2,3,3a,3b,4,5,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridin-7-one |
| SMILES | Cc1ccc(CC(=O)C2CCC3C4CNC5=CC(=O)CC[C@]5(C)C4CC[C@]23C)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C28H34F3NO3/c1-16-4-5-17(24(12-16)35-28(29,30)31)13-23(34)22-7-6-20-19-15-32-25-14-18(33)8-10-27(25,3)21(19)9-11-26(20,22)2/h4-5,12,14,19-22,32H,6-11,13,15H2,1-3H3/t19?,20?,21?,22?,26-,27+/m0/s1 |
| InChIKey | QLRBLMLJWFVNHD-IOHPNBQBSA-N |
| XLogP | 5.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |