C26H35FN4O2 — CID 158303428
[(8aS)-2,3,4,4a,5,6,8,8a-octahydropyrano[2,3-c]pyridin-7-yl]-[3-[(1S)-1-[2-[(4-fluoropiperidin-1-yl)methyl]phenyl]ethyl]imidazol-4-yl]methanone (PubChem CID 158303428) has the molecular formula C26H35FN4O2 and a molecular weight of 454.59 g/mol. Its IUPAC name is [(8aS)-2,3,4,4a,5,6,8,8a-octahydropyrano[2,3-c]pyridin-7-yl]-[3-[(1S)-1-[2-[(4-fluoropiperidin-1-yl)methyl]phenyl]ethyl]imidazol-4-yl]methanone.
| Compound Name | [(8aS)-2,3,4,4a,5,6,8,8a-octahydropyrano[2,3-c]pyridin-7-yl]-[3-[(1S)-1-[2-[(4-fluoropiperidin-1-yl)methyl]phenyl]ethyl]imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 158303428 |
| Molecular Formula | C26H35FN4O2 |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | [(8aS)-2,3,4,4a,5,6,8,8a-octahydropyrano[2,3-c]pyridin-7-yl]-[3-[(1S)-1-[2-[(4-fluoropiperidin-1-yl)methyl]phenyl]ethyl]imidazol-4-yl]methanone |
| SMILES | C[C@@H](c1ccccc1CN1CCC(F)CC1)n1cncc1C(=O)N1CCC2CCCO[C@@H]2C1 |
| InChI | InChI=1S/C26H35FN4O2/c1-19(23-7-3-2-5-21(23)16-29-11-9-22(27)10-12-29)31-18-28-15-24(31)26(32)30-13-8-20-6-4-14-33-25(20)17-30/h2-3,5,7,15,18-20,22,25H,4,6,8-14,16-17H2,1H3/t19-,20?,25+/m0/s1 |
| InChIKey | HAUNDGISZPQCFT-GLCHINNNSA-N |
| XLogP | 4.07 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |