C13H17BrO5 — CID 15830508
methyl (1S,2S,4R)-5-bromo-8,8-dimethoxy-1-methyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 15830508) has the molecular formula C13H17BrO5 and a molecular weight of 333.18 g/mol. Its IUPAC name is methyl (1S,2S,4R)-5-bromo-8,8-dimethoxy-1-methyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2S,4R)-5-bromo-8,8-dimethoxy-1-methyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 15830508 |
| Molecular Formula | C13H17BrO5 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | methyl (1S,2S,4R)-5-bromo-8,8-dimethoxy-1-methyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2C(Br)=C[C@@]1(C)C(=O)C2(OC)OC |
| InChI | InChI=1S/C13H17BrO5/c1-12-6-9(14)7(5-8(12)10(15)17-2)13(18-3,19-4)11(12)16/h6-8H,5H2,1-4H3/t7-,8+,12+/m0/s1 |
| InChIKey | LYVJLAMJPLRXOX-JOAULVNJSA-N |
| XLogP | 1.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|