C22H25ClN2O2 — CID 158306492
6-(4-aminophenyl)-1-[2-(2-chlorophenyl)pyrrolidin-1-yl]hexane-1,4-dione (PubChem CID 158306492) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 6-(4-aminophenyl)-1-[2-(2-chlorophenyl)pyrrolidin-1-yl]hexane-1,4-dione.
| Compound Name | 6-(4-aminophenyl)-1-[2-(2-chlorophenyl)pyrrolidin-1-yl]hexane-1,4-dione |
|---|---|
| PubChem CID | 158306492 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 6-(4-aminophenyl)-1-[2-(2-chlorophenyl)pyrrolidin-1-yl]hexane-1,4-dione |
| SMILES | Nc1ccc(CCC(=O)CCC(=O)N2CCCC2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H25ClN2O2/c23-20-5-2-1-4-19(20)21-6-3-15-25(21)22(27)14-13-18(26)12-9-16-7-10-17(24)11-8-16/h1-2,4-5,7-8,10-11,21H,3,6,9,12-15,24H2 |
| InChIKey | GVQZUHZRHNLMOB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|