C41H34Cl7N5O9S3 — CID 158307251
bis(N-benzyl-3,3-dichloro-1-methyl-2-oxoindole-5-sulfonamide);3,3-dichloro-1-methyl-2-oxoindole-5-sulfonyl chloride (PubChem CID 158307251) has the molecular formula C41H34Cl7N5O9S3 and a molecular weight of 1085.12 g/mol. Its IUPAC name is bis(N-benzyl-3,3-dichloro-1-methyl-2-oxoindole-5-sulfonamide);3,3-dichloro-1-methyl-2-oxoindole-5-sulfonyl chloride.
| Compound Name | bis(N-benzyl-3,3-dichloro-1-methyl-2-oxoindole-5-sulfonamide);3,3-dichloro-1-methyl-2-oxoindole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 158307251 |
| Molecular Formula | C41H34Cl7N5O9S3 |
| Molecular Weight | 1085.12 g/mol |
| Exact Mass | 1080.93 |
| IUPAC Name | bis(N-benzyl-3,3-dichloro-1-methyl-2-oxoindole-5-sulfonamide);3,3-dichloro-1-methyl-2-oxoindole-5-sulfonyl chloride |
| SMILES | CN1C(=O)C(Cl)(Cl)c2cc(S(=O)(=O)Cl)ccc21.CN1C(=O)C(Cl)(Cl)c2cc(S(=O)(=O)NCc3ccccc3)ccc21.CN1C(=O)C(Cl)(Cl)c2cc(S(=O)(=O)NCc3ccccc3)ccc21 |
| InChI | InChI=1S/2C16H14Cl2N2O3S.C9H6Cl3NO3S/c2*1-20-14-8-7-12(9-13(14)16(17,18)15(20)21)24(22,23)19-10-11-5-3-2-4-6-11;1-13-7-3-2-5(17(12,15)16)4-6(7)9(10,11)8(13)14/h2*2-9,19H,10H2,1H3;2-4H,1H3 |
| InChIKey | GNFQKIVGHKBSQH-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1085.12 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|