C14H23F3O4S2 — CID 158309144
(4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane (PubChem CID 158309144) has the molecular formula C14H23F3O4S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane.
| Compound Name | (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane |
|---|---|
| PubChem CID | 158309144 |
| Molecular Formula | C14H23F3O4S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane |
| SMILES | C.CCOC(=S)SC(CCC(C)=O)CC(OC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C13H19F3O4S2.CH4/c1-4-19-12(21)22-10(6-5-8(2)17)7-11(13(14,15)16)20-9(3)18;/h10-11H,4-7H2,1-3H3;1H4 |
| InChIKey | GNLPHZSJGMULJH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|