About (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane
(4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane (PubChem CID 158309144) has the molecular formula C14H23F3O4S2
and a molecular weight of 376.46 g/mol. Its IUPAC name is (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane.
Molecular Properties
| Compound Name | (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane |
| PubChem CID | 158309144 |
| Molecular Formula | C14H23F3O4S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane |
| SMILES | C.CCOC(=S)SC(CCC(C)=O)CC(OC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C13H19F3O4S2.CH4/c1-4-19-12(21)22-10(6-5-8(2)17)7-11(13(14,15)16)20-9(3)18;/h10-11H,4-7H2,1-3H3;1H4 |
| InChIKey | GNLPHZSJGMULJH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane?
The IUPAC name of (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane (CID 158309144) is (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane.
What is the SMILES notation for (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane?
The canonical SMILES for (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane is C.CCOC(=S)SC(CCC(C)=O)CC(OC(C)=O)C(F)(F)F.
What is the InChIKey of (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane?
The InChIKey is GNLPHZSJGMULJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3O4S2.CH4/c1-4-19-12(21)22-10(6-5-8(2)17)7-11(13(14,15)16)20-9(3)18;/h10-11H,4-7H2,1-3H3;1H4.
What are the key properties of (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane?
(4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane has a molecular weight of 376.46 g/mol, XLogP of 4.30, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxycarbothioylsulfanyl-1,1,1-trifluoro-7-oxooctan-2-yl) acetate;methane is sourced from PubChem (CID 158309144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).