C21H31NO4S2 — CID 158309223
N-[1-(4-hydroxyphenyl)-3-(2-hydroxypropoxy)propan-2-yl]-3-phenylpropanamide;sulfane (PubChem CID 158309223) has the molecular formula C21H31NO4S2 and a molecular weight of 425.62 g/mol. Its IUPAC name is N-[1-(4-hydroxyphenyl)-3-(2-hydroxypropoxy)propan-2-yl]-3-phenylpropanamide;sulfane.
| Compound Name | N-[1-(4-hydroxyphenyl)-3-(2-hydroxypropoxy)propan-2-yl]-3-phenylpropanamide;sulfane |
|---|---|
| PubChem CID | 158309223 |
| Molecular Formula | C21H31NO4S2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-[1-(4-hydroxyphenyl)-3-(2-hydroxypropoxy)propan-2-yl]-3-phenylpropanamide;sulfane |
| SMILES | CC(O)COCC(Cc1ccc(O)cc1)NC(=O)CCc1ccccc1.S.S |
| InChI | InChI=1S/C21H27NO4.2H2S/c1-16(23)14-26-15-19(13-18-7-10-20(24)11-8-18)22-21(25)12-9-17-5-3-2-4-6-17;;/h2-8,10-11,16,19,23-24H,9,12-15H2,1H3,(H,22,25);2*1H2 |
| InChIKey | GNLVOYFUUFJHAU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |