C17H16F4N2O6 — CID 158310227
methyl 5-hydroxypyridine-2-carboxylate;methyl 5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxylate (PubChem CID 158310227) has the molecular formula C17H16F4N2O6 and a molecular weight of 420.32 g/mol. Its IUPAC name is methyl 5-hydroxypyridine-2-carboxylate;methyl 5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxylate.
| Compound Name | methyl 5-hydroxypyridine-2-carboxylate;methyl 5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 158310227 |
| Molecular Formula | C17H16F4N2O6 |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | methyl 5-hydroxypyridine-2-carboxylate;methyl 5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(O)cn1.COC(=O)c1ccc(OCC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C10H9F4NO3.C7H7NO3/c1-17-8(16)7-3-2-6(4-15-7)18-5-10(13,14)9(11)12;1-11-7(10)6-3-2-5(9)4-8-6/h2-4,9H,5H2,1H3;2-4,9H,1H3 |
| InChIKey | GNPARBWMBSBEJU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|