C30H40N2O4 — CID 158312287
2-[2-(oxan-3-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 158312287) has the molecular formula C30H40N2O4 and a molecular weight of 492.66 g/mol. Its IUPAC name is 2-[2-(oxan-3-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[2-(oxan-3-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 158312287 |
| Molecular Formula | C30H40N2O4 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | 2-[2-(oxan-3-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)C(c1ccccc1C1CCCOC1)N1CC[C@@H](OCCCCc2ccc3c(n2)CCCC3)C1 |
| InChI | InChI=1S/C30H40N2O4/c33-30(34)29(27-12-3-2-11-26(27)23-9-7-18-35-21-23)32-17-16-25(20-32)36-19-6-5-10-24-15-14-22-8-1-4-13-28(22)31-24/h2-3,11-12,14-15,23,25,29H,1,4-10,13,16-21H2,(H,33,34)/t23?,25-,29?/m1/s1 |
| InChIKey | GNVALQJJWNAMBC-VSNSVUJFSA-N |
| XLogP | 5.09 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|