C12H16O5 — CID 158314329
[(2E)-2-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate (PubChem CID 158314329) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is [(2E)-2-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate.
| Compound Name | [(2E)-2-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate |
|---|---|
| PubChem CID | 158314329 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [(2E)-2-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate |
| SMILES | C=CCC(=O)OC/C(C)=C1/OC(=O)OC1(C)C |
| InChI | InChI=1S/C12H16O5/c1-5-6-9(13)15-7-8(2)10-12(3,4)17-11(14)16-10/h5H,1,6-7H2,2-4H3/b10-8+ |
| InChIKey | GOBNTCNLGGFSOM-CSKARUKUSA-N |
| XLogP | 2.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|