About 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine
2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine (PubChem CID 158315950) has the molecular formula C15H25F6N3
and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine |
| PubChem CID | 158315950 |
| Molecular Formula | C15H25F6N3 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine |
| SMILES | FC(F)(F)C1CCCN1.FC(F)(F)C1CCCN1C1CCNCC1 |
| InChI | InChI=1S/C10H17F3N2.C5H8F3N/c11-10(12,13)9-2-1-7-15(9)8-3-5-14-6-4-8;6-5(7,8)4-2-1-3-9-4/h8-9,14H,1-7H2;4,9H,1-3H2 |
| InChIKey | GOGJXTDOMJYPRD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine?
The IUPAC name of 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine (CID 158315950) is 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine.
What is the SMILES notation for 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine?
The canonical SMILES for 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine is FC(F)(F)C1CCCN1.FC(F)(F)C1CCCN1C1CCNCC1.
What is the InChIKey of 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine?
The InChIKey is GOGJXTDOMJYPRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2.C5H8F3N/c11-10(12,13)9-2-1-7-15(9)8-3-5-14-6-4-8;6-5(7,8)4-2-1-3-9-4/h8-9,14H,1-7H2;4,9H,1-3H2.
What are the key properties of 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine?
2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine has a molecular weight of 361.37 g/mol, XLogP of 3.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)pyrrolidine;4-[2-(trifluoromethyl)pyrrolidin-1-yl]piperidine is sourced from PubChem (CID 158315950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).