C12H15F3O3 — CID 158318334
2-(difluoromethoxy)-1-(2-fluoro-3-methoxyphenyl)butan-2-ol (PubChem CID 158318334) has the molecular formula C12H15F3O3 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-(difluoromethoxy)-1-(2-fluoro-3-methoxyphenyl)butan-2-ol.
| Compound Name | 2-(difluoromethoxy)-1-(2-fluoro-3-methoxyphenyl)butan-2-ol |
|---|---|
| PubChem CID | 158318334 |
| Molecular Formula | C12H15F3O3 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-(difluoromethoxy)-1-(2-fluoro-3-methoxyphenyl)butan-2-ol |
| SMILES | CCC(O)(Cc1cccc(OC)c1F)OC(F)F |
| InChI | InChI=1S/C12H15F3O3/c1-3-12(16,18-11(14)15)7-8-5-4-6-9(17-2)10(8)13/h4-6,11,16H,3,7H2,1-2H3 |
| InChIKey | GONQUZRBPIMHOJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|