C24H54O8 — CID 158318651
methane;bis((3R)-3-methylpentanoic acid);(3R)-3-propanoyloxypentanoic acid (PubChem CID 158318651) has the molecular formula C24H54O8 and a molecular weight of 470.69 g/mol. Its IUPAC name is methane;bis((3R)-3-methylpentanoic acid);(3R)-3-propanoyloxypentanoic acid.
| Compound Name | methane;bis((3R)-3-methylpentanoic acid);(3R)-3-propanoyloxypentanoic acid |
|---|---|
| PubChem CID | 158318651 |
| Molecular Formula | C24H54O8 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | methane;bis((3R)-3-methylpentanoic acid);(3R)-3-propanoyloxypentanoic acid |
| SMILES | C.C.C.C.CCC(=O)O[C@H](CC)CC(=O)O.CC[C@@H](C)CC(=O)O.CC[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C8H14O4.2C6H12O2.4CH4/c1-3-6(5-7(9)10)12-8(11)4-2;2*1-3-5(2)4-6(7)8;;;;/h6H,3-5H2,1-2H3,(H,9,10);2*5H,3-4H2,1-2H3,(H,7,8);4*1H4/t6-;2*5-;;;;/m111..../s1 |
| InChIKey | GOOOGHWIOFCHQK-DDPZCFFFSA-N |
| XLogP | 6.75 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |